diff --git a/build/main.py b/build/main.py old mode 100755 new mode 100644 diff --git a/config/InvTweaks/InvTweaks.cfg b/config/InvTweaks/InvTweaks.cfg new file mode 100644 index 00000000..145aa4a2 --- /dev/null +++ b/config/InvTweaks/InvTweaks.cfg @@ -0,0 +1,23 @@ +#Inventory Tweaks Configuration +#(Regarding shortcuts, all key names can be found at: http://legacy.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html) +#Tue Dec 07 20:44:40 EST 2021 +enableMiddleClick=true +showChestButtons=true +enableSortingOnPickup=false +enableAutoRefill=true +autoRefillBeforeBreak=false +autoRefillDamageThreshhold=5 +enableSounds=true +enableShortcuts=true +enableAutoEquipArmor=false +enableServerItemSwap=true +enableConfigLoadedMesssage=false +invertToolDamageSorting=true +shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT +shortcutKeyEverything=SPACE +shortcutKeyOneItem=LCONTROL, RCONTROL +shortcutKeyToUpperSection=UP +shortcutKeyToLowerSection=DOWN +shortcutKeyDrop=LALT, RALT +enableToolTipTreePath=false +version=1.64+dev.151.822d839 diff --git a/config/InvTweaks/InvTweaksRules.txt b/config/InvTweaks/InvTweaksRules.txt new file mode 100644 index 00000000..b8b0fa63 --- /dev/null +++ b/config/InvTweaks/InvTweaksRules.txt @@ -0,0 +1,31 @@ +|=================================================================| +| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org | +| Sorting rules and general configuration | +|=================================================================| + +====== [ SETTINGS ] ====== + +D LOCKED + +======== [ GETTING STARTED ] ======== + +# SORTING RULES +# Each line you type is a new constraint you add for sorting your inventory. +# After any change, just press the sorting key to reload the settings. Some examples: +# * "D1 sword" puts any sword in row D, column 1 (see grid below) +# * "A edibleFood" fills the A row with food +# * "1 ironPickaxe" fills the 1 column with an iron pickaxe +# * "A1-C4 blocks" fills the rectangle with any blocks +# * "D LOCKED" avoids items from the hotbar to move out of it when sorting + +# INVENTORY GRID +# 1 2 3 4 5 6 7 8 9 +# A [A1][A2][A3][A4][A5][A6][A7][A8][A9] +# B [B1][B2][B3][B4][B5][B6][B7][B8][B9] +# C [C1][C2][C3][C4][C5][C6][C7][C8][C9] +# +# D [D1][D2][D3][D4][D5][D6][D7][D8][D9] + +# AVAILABLE KEYWORDS +# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item +# is missing from the item tree (for example mod items), you can add it there. \ No newline at end of file diff --git a/config/InvTweaks/InvTweaksTree.txt b/config/InvTweaks/InvTweaksTree.txt new file mode 100644 index 00000000..fad4bf1e --- /dev/null +++ b/config/InvTweaks/InvTweaksTree.txt @@ -0,0 +1,1210 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/config/InvTweaks/trees/readme.txt b/config/InvTweaks/trees/readme.txt new file mode 100644 index 00000000..3df06a57 --- /dev/null +++ b/config/InvTweaks/trees/readme.txt @@ -0,0 +1,5 @@ +You may add additional ".tree" files to this folder and they will be merged into either the "minecraft.tree" file if it is in this folder or the normal InvTweakTree.txt file if "minecraft.tree" does not exist. These tree files have the same structure as the InvTweakTree.txt file, and matching categories will be merged into one with nodes from the new tree file being added to the end of the matching category. + +You can find tree files maintained by IMarvinTPA at https://github.com/IMarvinTPA/InventoryTweaksTrees + + diff --git a/manifest.json b/manifest.json index 27b61628..c8b94c2b 100644 --- a/manifest.json +++ b/manifest.json @@ -22,6 +22,7 @@ "required": true }, { + "clientOnly": true, "projectID": 461660, "fileID": 4661407, "required": true @@ -37,6 +38,7 @@ "required": true }, { + "clientOnly": true, "projectID": 250398, "fileID": 4428378, "required": true @@ -82,11 +84,13 @@ "required": true }, { + "clientOnly": true, "projectID": 250419, "fileID": 2898966, "required": true }, { + "clientOnly": true, "projectID": 513857, "fileID": 3739783, "required": true @@ -101,6 +105,11 @@ "fileID": 2819669, "required": true }, + { + "projectID": 223094, + "fileID": 2923460, + "required": true + }, { "projectID": 298187, "fileID": 3005950, @@ -127,6 +136,7 @@ "required": true }, { + "clientOnly": true, "projectID": 226447, "fileID": 2477566, "required": true @@ -137,6 +147,7 @@ "required": true }, { + "clientOnly": true, "projectID": 265917, "fileID": 2951731, "required": true @@ -152,6 +163,7 @@ "required": true }, { + "clientOnly": true, "projectID": 251407, "fileID": 2624712, "required": true @@ -172,6 +184,7 @@ "required": true }, { + "clientOnly": true, "projectID": 314002, "fileID": 2719400, "required": true @@ -187,6 +200,7 @@ "required": true }, { + "clientOnly": true, "projectID": 243478, "fileID": 2745657, "required": true @@ -197,6 +211,7 @@ "required": true }, { + "clientOnly": true, "projectID": 238747, "fileID": 2739582, "required": true @@ -207,6 +222,7 @@ "required": true }, { + "clientOnly": true, "projectID": 231275, "fileID": 2801170, "required": true @@ -217,6 +233,7 @@ "required": true }, { + "clientOnly": true, "projectID": 282313, "fileID": 2689835, "required": true @@ -252,6 +269,7 @@ "required": true }, { + "clientOnly": true, "projectID": 383632, "fileID": 3056455, "required": true @@ -287,6 +305,7 @@ "required": true }, { + "clientOnly": true, "projectID": 306555, "fileID": 2707092, "required": true @@ -322,6 +341,7 @@ "required": true }, { + "clientOnly": true, "projectID": 272515, "fileID": 2685984, "required": true @@ -387,6 +407,7 @@ "required": true }, { + "clientOnly": true, "projectID": 408853, "fileID": 4439001, "required": true @@ -405,16 +426,6 @@ "projectID": 895539, "fileID": 4729414, "required": true - }, - { - "projectID": 632327, - "fileID": 4779326, - "required": true - }, - { - "projectID": 624243, - "fileID": 4779300, - "required": true } ] -} \ No newline at end of file +}