diff --git a/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.json b/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.json
index 96a029d1..1b833415 100644
--- a/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.json
+++ b/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.json
@@ -11,6 +11,17 @@
"molFormula": "C15H16O2",
"monoisotopicMass": 228.115029755,
"percentAssays": 23.0,
+ "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
+ "inchiString": "InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3\n",
+ "qcNotes": null,
+ "qsarReadySmiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
+ "msReadySmiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
+ "irisLink": "356",
+ "pprtvLink": null,
+ "descriptorStringTsv": "0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t1\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t1\t1\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0",
+ "isMarkush": false,
+ "inchikey": "IISBACLAFKSPIT-UHFFFAOYSA-N",
+ "wikipediaArticle": "Bisphenol A",
"pubchemCount": 212,
"pubmedCount": 3850.0,
"sourcesCount": 146,
@@ -25,17 +36,6 @@
"relatedStructureCount": 24,
"hasStructureImage": 1,
"iupacName": "4,4'-(Propane-2,2-diyl)diphenol",
- "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
- "inchiString": "InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3\n",
- "qcNotes": null,
- "qsarReadySmiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
- "msReadySmiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
- "irisLink": "356",
- "pprtvLink": null,
- "descriptorStringTsv": "0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t1\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t1\t1\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0",
- "isMarkush": false,
- "inchikey": "IISBACLAFKSPIT-UHFFFAOYSA-N",
- "wikipediaArticle": "Bisphenol A",
"cpdataCount": 292
}
]
diff --git a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R
index 1c6340fa..adbadfca 100644
--- a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R
+++ b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtxcid/DTXCID30182?Image+Format=png",
status_code = 200L, headers = structure(list(`content-type` = "image/png",
`content-length` = "22764", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:55 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "5645ba9a-0b7d-4567-5a13-77d6911b988c",
+ `x-vcap-request-id` = "eb3e8ffb-6e4f-4403-594f-5f780bd13bc4",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Miss from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "4Ri4uJmCv4rDWmuQ-sMwRNjwLuMFUSDsVa_r3C7hyAm9MaebTkuesw=="), class = c("insensitive",
+ `x-cache` = "Miss from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "UhSxAl-j7H8H4Xzp3oKCHIfmtUcRINnM5PyozUKP-VQiX4sTnn7DoQ=="), class = c("insensitive",
"list")), all_headers = list(list(status = 200L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "image/png",
`content-length` = "22764", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:55 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "5645ba9a-0b7d-4567-5a13-77d6911b988c",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "eb3e8ffb-6e4f-4403-594f-5f780bd13bc4",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Miss from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "4Ri4uJmCv4rDWmuQ-sMwRNjwLuMFUSDsVa_r3C7hyAm9MaebTkuesw=="), class = c("insensitive",
+ `x-cache` = "Miss from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "UhSxAl-j7H8H4Xzp3oKCHIfmtUcRINnM5PyozUKP-VQiX4sTnn7DoQ=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -2296,7 +2296,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtx
0x00, 0x08, 0x19, 0x01, 0x0b, 0x00, 0x00, 0x20, 0x64, 0x04,
0x2c, 0x00, 0x00, 0x80, 0x90, 0xfd, 0x3f, 0xca, 0x71, 0x75,
0x8f, 0x81, 0x96, 0xf0, 0x66, 0x00, 0x00, 0x00, 0x00, 0x49,
- 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1730735815, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.9e-05,
- connect = 0, pretransfer = 0.00025, starttransfer = 0.146965,
- total = 0.148415)), class = "response")
+ 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1731080117, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.4e-05,
+ connect = 0, pretransfer = 0.000173, starttransfer = 0.117374,
+ total = 0.117778)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R
index fe8996e6..3f8f7217 100644
--- a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R
+++ b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtxsid/?Image+Format=svg",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:55 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:18 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "b861d8b8-4efc-45b6-7117-a31eae585fcf",
+ `x-vcap-request-id` = "cddbbc91-17f0-40a2-5d6a-b3fd9d1f6a45",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "PYMAqcJWGxrs675GD4tYMRHen4wpiy7SOR2dt7w6YlF4foDQSe6EyQ=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "9aGBULIGqN7yyegZADC9rfS-z48SZ0EatC259fH4bIDPSOlOLbYBfQ=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:55 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:18 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "b861d8b8-4efc-45b6-7117-a31eae585fcf",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "cddbbc91-17f0-40a2-5d6a-b3fd9d1f6a45",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "PYMAqcJWGxrs675GD4tYMRHen4wpiy7SOR2dt7w6YlF4foDQSe6EyQ=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "9aGBULIGqN7yyegZADC9rfS-z48SZ0EatC259fH4bIDPSOlOLbYBfQ=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtx
0x61, 0x6c, 0x2f, 0x66, 0x69, 0x6c, 0x65, 0x2f, 0x69, 0x6d,
0x61, 0x67, 0x65, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68,
0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64,
- 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735815, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.3e-05,
- connect = 0, pretransfer = 0.000203, starttransfer = 0.208114,
- total = 0.208166)), class = "response")
+ 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080118, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 7.4e-05,
+ connect = 0, pretransfer = 0.000173, starttransfer = 0.24306,
+ total = 0.243096)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R
index a406ba9a..ce668e47 100644
--- a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R
+++ b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R
@@ -1,23 +1,23 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtxsid/DTXSID7020182",
status_code = 200L, headers = structure(list(`content-type` = "image/png",
`content-length` = "22764", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:54 GMT", `x-frame-options` = "DENY",
+ date = "Fri, 08 Nov 2024 15:35:17 GMT", `x-frame-options` = "DENY",
`cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "ff95c916-6d4d-4e6b-5ce3-98d8ba2e7737",
+ `x-vcap-request-id` = "732cf0d3-704f-4192-7dd5-bafe4405b8b0",
`x-xss-protection` = "1; mode=block", `x-cache` = "Miss from cloudfront",
- via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "KfxgTt6DhL7cs_ZojCgfRu1FImpzf1RW3OmO0-GPKCR-0ivvC1sWsg=="), class = c("insensitive",
+ via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Kht9wxb7mGmfVj9eihlReqjSxsMD010t2OrV87Uqu5ACjhzZEnbOfw=="), class = c("insensitive",
"list")), all_headers = list(list(status = 200L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "image/png",
`content-length` = "22764", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:54 GMT", `x-frame-options` = "DENY",
+ date = "Fri, 08 Nov 2024 15:35:17 GMT", `x-frame-options` = "DENY",
`cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ff95c916-6d4d-4e6b-5ce3-98d8ba2e7737",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "732cf0d3-704f-4192-7dd5-bafe4405b8b0",
`x-xss-protection` = "1; mode=block", `x-cache` = "Miss from cloudfront",
- via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "KfxgTt6DhL7cs_ZojCgfRu1FImpzf1RW3OmO0-GPKCR-0ivvC1sWsg=="), class = c("insensitive",
+ via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Kht9wxb7mGmfVj9eihlReqjSxsMD010t2OrV87Uqu5ACjhzZEnbOfw=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -2298,7 +2298,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtx
0x00, 0x08, 0x19, 0x01, 0x0b, 0x00, 0x00, 0x20, 0x64, 0x04,
0x2c, 0x00, 0x00, 0x80, 0x90, 0xfd, 0x3f, 0xca, 0x71, 0x75,
0x8f, 0x81, 0x96, 0xf0, 0x66, 0x00, 0x00, 0x00, 0x00, 0x49,
- 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1730735814, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.5e-05,
- connect = 0, pretransfer = 0.000152, starttransfer = 0.087115,
- total = 0.08839)), class = "response")
+ 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1731080117, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.2e-05,
+ connect = 0, pretransfer = 0.000138, starttransfer = 0.111975,
+ total = 0.112136)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R
index 09dc2152..8a3f590c 100644
--- a/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R
+++ b/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/file/mol/search/by-dtxsid/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:54 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "9a59f4ac-0f4c-4653-474d-e706cdb42954",
+ `x-vcap-request-id` = "169affdf-77aa-4c07-64ef-8d93b0f2aa2c",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "WrJCBpJEojV4ffsJSIdvM-tDvwb7iE3zo2WU841tx8vG-QnEmTXbNA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "oFPU47RlRIuvxq9BNwacktkRkOIQJhL02m1wTDr3BPE4AddtAUjlcw=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:54 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "9a59f4ac-0f4c-4653-474d-e706cdb42954",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "169affdf-77aa-4c07-64ef-8d93b0f2aa2c",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "WrJCBpJEojV4ffsJSIdvM-tDvwb7iE3zo2WU841tx8vG-QnEmTXbNA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "oFPU47RlRIuvxq9BNwacktkRkOIQJhL02m1wTDr3BPE4AddtAUjlcw=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/mol/search/by-dtxsi
0x2f, 0x66, 0x69, 0x6c, 0x65, 0x2f, 0x6d, 0x6f, 0x6c, 0x2f,
0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d,
0x64, 0x74, 0x78, 0x73, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d
- )), date = structure(1730735814, class = c("POSIXct", "POSIXt"
+ )), date = structure(1731080117, class = c("POSIXct", "POSIXt"
), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.1e-05,
- connect = 0, pretransfer = 0.000171, starttransfer = 0.088264,
- total = 0.088293)), class = "response")
+ connect = 0, pretransfer = 0.000119, starttransfer = 0.23042,
+ total = 0.230492)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R
index 7286baaf..e7bb8a22 100644
--- a/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R
+++ b/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/file/mrv/search/by-dtxsid/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:54 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:16 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "f1001cf5-62cd-423d-4f66-b43b2639ff39",
+ `x-vcap-request-id` = "43da6ac3-0f69-4a17-6ba6-b5006fc59054",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BD_22ZYMRJv2Fk5iXIJwB3MivA3pRcJP9w95E780BPUjNTKrzWVgtw=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "BGptkHrzR290QlXxUc51C8OigFUZugk0GX-2NNPo8t0MetmhlE6cEg=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:54 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:16 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f1001cf5-62cd-423d-4f66-b43b2639ff39",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "43da6ac3-0f69-4a17-6ba6-b5006fc59054",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BD_22ZYMRJv2Fk5iXIJwB3MivA3pRcJP9w95E780BPUjNTKrzWVgtw=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "BGptkHrzR290QlXxUc51C8OigFUZugk0GX-2NNPo8t0MetmhlE6cEg=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/mrv/search/by-dtxsi
0x2f, 0x66, 0x69, 0x6c, 0x65, 0x2f, 0x6d, 0x72, 0x76, 0x2f,
0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d,
0x64, 0x74, 0x78, 0x73, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d
- )), date = structure(1730735814, class = c("POSIXct", "POSIXt"
- ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.8e-05,
- connect = 0, pretransfer = 0.000192, starttransfer = 0.083966,
- total = 0.083996)), class = "response")
+ )), date = structure(1731080116, class = c("POSIXct", "POSIXt"
+ ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.2e-05,
+ connect = 0, pretransfer = 0.000136, starttransfer = 0.236461,
+ total = 0.236525)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R
index 05871460..414a3b1c 100644
--- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R
+++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/contain//",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:12 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "ef9438dc-f1dc-414c-6098-59a64f01350d",
+ `x-vcap-request-id` = "218087b7-0027-44c4-5cb1-fbc7fbd11114",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "--LpA36WtWSC2adHvMlsxkskXvlepcgLT_03tnrjn_mSFAVPuMnOHA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "8o54Erp9D47FW27Hce3S7OZCMQ1yaHDvmrt_BLQwiOmIFb8zdhvMPQ=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:12 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ef9438dc-f1dc-414c-6098-59a64f01350d",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "218087b7-0027-44c4-5cb1-fbc7fbd11114",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "--LpA36WtWSC2adHvMlsxkskXvlepcgLT_03tnrjn_mSFAVPuMnOHA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "8o54Erp9D47FW27Hce3S7OZCMQ1yaHDvmrt_BLQwiOmIFb8zdhvMPQ=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/co
0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f,
0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x73, 0x2f,
0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x63, 0x6f, 0x6e,
- 0x74, 0x61, 0x69, 0x6e, 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735813, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.3e-05,
- connect = 0, pretransfer = 0.000145, starttransfer = 0.089194,
- total = 0.090008)), class = "response")
+ 0x74, 0x61, 0x69, 0x6e, 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080112, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.4e-05,
+ connect = 0, pretransfer = 0.000127, starttransfer = 0.238459,
+ total = 0.238493)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R
index 9adcfe2e..a6583b7c 100644
--- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R
+++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/contain/DTXSID7020182/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:11 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "e118fcfa-c517-4170-6fbf-8c5071cea504",
+ `x-vcap-request-id` = "c424f094-5554-4833-4445-9c9a69bc36e8",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "qfs-JmCqX5CvMiZh2iR3rnZOpLfzLc0Op42WyJwGCHQtdYkqpH_WBA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "CGtpRrbISoOWhsDXtaFnRy8IhRwGjafMSHS8If9YU2dRlhrtOYH6SQ=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:11 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e118fcfa-c517-4170-6fbf-8c5071cea504",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "c424f094-5554-4833-4445-9c9a69bc36e8",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "qfs-JmCqX5CvMiZh2iR3rnZOpLfzLc0Op42WyJwGCHQtdYkqpH_WBA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "CGtpRrbISoOWhsDXtaFnRy8IhRwGjafMSHS8If9YU2dRlhrtOYH6SQ=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -43,7 +43,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/co
0x61, 0x6c, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68,
0x2f, 0x63, 0x6f, 0x6e, 0x74, 0x61, 0x69, 0x6e, 0x2f, 0x44,
0x54, 0x58, 0x53, 0x49, 0x44, 0x37, 0x30, 0x32, 0x30, 0x31,
- 0x38, 0x32, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735771, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.3e-05,
- connect = 0, pretransfer = 0.000264, starttransfer = 0.015368,
- total = 0.015406)), class = "response")
+ 0x38, 0x32, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080067, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.7e-05,
+ connect = 0, pretransfer = 0.000132, starttransfer = 0.033462,
+ total = 0.033513)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R
index 77003b45..e2598b44 100644
--- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R
+++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/equal//",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:12 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "4c13dd9a-74e2-4e19-5e34-6e600dcd9d43",
+ `x-vcap-request-id` = "e682177d-d04b-4a63-5ca0-4630a5f8ef34",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "bR8j13beKi7LWGEQcHzpn9R6myqmZOfjGYGv27-YdpMAo1vXRlqWfQ=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "59oWFR5qzHPAMFu5BDS95Y5p7c14ygPmBZ6GnZhV8NgSrys1CSqePA=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:12 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "4c13dd9a-74e2-4e19-5e34-6e600dcd9d43",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e682177d-d04b-4a63-5ca0-4630a5f8ef34",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "bR8j13beKi7LWGEQcHzpn9R6myqmZOfjGYGv27-YdpMAo1vXRlqWfQ=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "59oWFR5qzHPAMFu5BDS95Y5p7c14ygPmBZ6GnZhV8NgSrys1CSqePA=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/eq
0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x63, 0x68,
0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x73, 0x2f, 0x73, 0x65,
0x61, 0x72, 0x63, 0x68, 0x2f, 0x65, 0x71, 0x75, 0x61, 0x6c,
- 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735813, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.1e-05,
- connect = 0, pretransfer = 0.000153, starttransfer = 0.212778,
- total = 0.212806)), class = "response")
+ 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080112, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.4e-05,
+ connect = 0, pretransfer = 0.000144, starttransfer = 0.107501,
+ total = 0.107544)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R
index 16b86c5c..82bbdc96 100644
--- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R
+++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/equal/DTXSID7020182/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:11 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:26 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "79220573-f971-4d0d-798c-86c9dbd6d286",
+ `x-vcap-request-id` = "130796fc-dda0-4839-4ae6-2ef1bd9d510e",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "PPEcWiHqw2RMtAc8WtLMwgE2hbv15QGX0oVSmtJqrisAVRCNN74iFA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Phy6D3VYgAh6otZoqE8PTawGqhrBWGzQPDb22d9SWAnPeLIAnS-qKg=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:11 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:26 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "79220573-f971-4d0d-798c-86c9dbd6d286",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "130796fc-dda0-4839-4ae6-2ef1bd9d510e",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "PPEcWiHqw2RMtAc8WtLMwgE2hbv15QGX0oVSmtJqrisAVRCNN74iFA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Phy6D3VYgAh6otZoqE8PTawGqhrBWGzQPDb22d9SWAnPeLIAnS-qKg=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -43,7 +43,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/eq
0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x65,
0x71, 0x75, 0x61, 0x6c, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49,
0x44, 0x37, 0x30, 0x32, 0x30, 0x31, 0x38, 0x32, 0x2f, 0x22,
- 0x0a, 0x7d)), date = structure(1730735771, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.9e-05,
- connect = 0, pretransfer = 0.000189, starttransfer = 0.017674,
- total = 0.017701)), class = "response")
+ 0x0a, 0x7d)), date = structure(1731080066, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.3e-05,
+ connect = 0, pretransfer = 0.000154, starttransfer = 0.03253,
+ total = 0.032569)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R
index c1e8efaf..02e0bbe1 100644
--- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R
+++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/start-with//",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:52 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:08 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "3094d94d-2026-4704-6acb-7c22962fd3cf",
+ `x-vcap-request-id` = "6ec495ed-4028-4ebe-5149-1b615964334d",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "hQ8_ThXAuCSu5KzH8k4Ezbcikri56RYqmvWeVsr7BvmDatl39GqEjA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "jgOndjCssVfJUmG2wTFZUgCP3TRc64PAfJSNb72y8GMogx36ch_a6Q=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:52 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:08 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "3094d94d-2026-4704-6acb-7c22962fd3cf",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6ec495ed-4028-4ebe-5149-1b615964334d",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "hQ8_ThXAuCSu5KzH8k4Ezbcikri56RYqmvWeVsr7BvmDatl39GqEjA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "jgOndjCssVfJUmG2wTFZUgCP3TRc64PAfJSNb72y8GMogx36ch_a6Q=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -41,7 +41,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/st
0x73, 0x74, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61,
0x6c, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f,
0x73, 0x74, 0x61, 0x72, 0x74, 0x2d, 0x77, 0x69, 0x74, 0x68,
- 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735812, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.3e-05,
- connect = 0, pretransfer = 0.000229, starttransfer = 0.222289,
- total = 0.222321)), class = "response")
+ 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080108, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.8e-05,
+ connect = 0, pretransfer = 0.000162, starttransfer = 0.238366,
+ total = 0.238427)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R
index 537dc24f..3b05e39e 100644
--- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R
+++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/start-with/DTXSID7020182/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:11 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:26 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "ee231131-2631-4b96-6007-0c2c347597eb",
+ `x-vcap-request-id` = "9bb2e335-0471-431c-7942-cc9ff3ff2a46",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "WqYEmnD5L2aICiESxBqNWg67wsS38UEAX7w9ZDVVHoFdG14YJI5X7Q=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Mely9QGbAPkIJer7b4UpcWF0CDafoTk0LJxOFxLZXwO6Y5efr8m2Bw=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:11 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:26 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ee231131-2631-4b96-6007-0c2c347597eb",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "9bb2e335-0471-431c-7942-cc9ff3ff2a46",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "WqYEmnD5L2aICiESxBqNWg67wsS38UEAX7w9ZDVVHoFdG14YJI5X7Q=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Mely9QGbAPkIJer7b4UpcWF0CDafoTk0LJxOFxLZXwO6Y5efr8m2Bw=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -44,7 +44,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/st
0x72, 0x63, 0x68, 0x2f, 0x73, 0x74, 0x61, 0x72, 0x74, 0x2d,
0x77, 0x69, 0x74, 0x68, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49,
0x44, 0x37, 0x30, 0x32, 0x30, 0x31, 0x38, 0x32, 0x2f, 0x22,
- 0x0a, 0x7d)), date = structure(1730735771, class = c("POSIXct",
+ 0x0a, 0x7d)), date = structure(1731080066, class = c("POSIXct",
"POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.7e-05,
- connect = 0, pretransfer = 2e-04, starttransfer = 0.016849,
- total = 0.016876)), class = "response")
+ connect = 0, pretransfer = 0.000115, starttransfer = 0.03561,
+ total = 0.035638)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R
index f1654f41..04ba5dae 100644
--- a/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R
+++ b/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-dtxsid/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:52 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:07 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "f92ae088-e954-4b53-6c48-ae0b39424986",
+ `x-vcap-request-id` = "f2383e81-a567-46e4-6bc3-cc8264a427dc",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "nyXNB5lsNG-GI0EyNVuj5Tpebn00piXF1F6Q2jjrMqD4mNyetgk3ZA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Npfmz9tiEM83iusbnkILHYCfp-fGclRfmAMq4pV9QK7_BCYGi4jhQg=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:52 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:07 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f92ae088-e954-4b53-6c48-ae0b39424986",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f2383e81-a567-46e4-6bc3-cc8264a427dc",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "nyXNB5lsNG-GI0EyNVuj5Tpebn00piXF1F6Q2jjrMqD4mNyetgk3ZA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Npfmz9tiEM83iusbnkILHYCfp-fGclRfmAMq4pV9QK7_BCYGi4jhQg=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-dtxsid/",
0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73,
0x74, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62,
0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64, 0x2f, 0x22,
- 0x0a, 0x7d)), date = structure(1730735812, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6e-05,
- connect = 0, pretransfer = 0.000214, starttransfer = 0.221006,
- total = 0.221048)), class = "response")
+ 0x0a, 0x7d)), date = structure(1731080107, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.6e-05,
+ connect = 0, pretransfer = 0.000157, starttransfer = 0.229666,
+ total = 0.229702)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R b/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R
index 064bb01a..41191917 100644
--- a/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R
+++ b/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/?projection=chemicallistwithdtxsids",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:16 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "f0061cb3-749b-48b8-615f-e33a3af896d5",
+ `x-vcap-request-id` = "31fb80bb-4fb1-41dc-5af9-7f42c6445925",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "p7hw0VjuWa0iF6V-gewJ7CIJ3hVQYjJjik7lYpmuzVSKJU6KIkXQZQ=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "dl_GVkJoKAsMS0-OzQDMgapqr51asTD5s-z32UL6GL3F5JvGZDqWzg=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:16 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f0061cb3-749b-48b8-615f-e33a3af896d5",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "31fb80bb-4fb1-41dc-5af9-7f42c6445925",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "p7hw0VjuWa0iF6V-gewJ7CIJ3hVQYjJjik7lYpmuzVSKJU6KIkXQZQ=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "dl_GVkJoKAsMS0-OzQDMgapqr51asTD5s-z32UL6GL3F5JvGZDqWzg=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -38,7 +38,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/?pro
0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d,
0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f,
0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d,
- 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735813, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.1e-05,
- connect = 0, pretransfer = 0.00025, starttransfer = 0.085773,
- total = 0.085803)), class = "response")
+ 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080116, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.6e-05,
+ connect = 0, pretransfer = 0.000132, starttransfer = 0.237174,
+ total = 0.237206)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name.R b/tests/testthat/chemical-batch/chemical/list/search/by-name.R
index b9e3abee..128938cf 100644
--- a/tests/testthat/chemical-batch/chemical/list/search/by-name.R
+++ b/tests/testthat/chemical-batch/chemical/list/search/by-name.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:07 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "d01a16e9-4946-49ac-712e-db0153977943",
+ `x-vcap-request-id` = "1d29b9a3-3bdd-4ea5-622d-f37e824828dd",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "lc12DbxpNAYMfTk3gyCAKJ5CHqyERDj-4BqX-J4akch1V_Z9j4I4Yg=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "b1mWQx22Y5Mq_l5xfOIG6R4_fTyzYU8aCHRRbFetnbSdiGKPwTt9mg=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:07 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d01a16e9-4946-49ac-712e-db0153977943",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "1d29b9a3-3bdd-4ea5-622d-f37e824828dd",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "lc12DbxpNAYMfTk3gyCAKJ5CHqyERDj-4BqX-J4akch1V_Z9j4I4Yg=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "b1mWQx22Y5Mq_l5xfOIG6R4_fTyzYU8aCHRRbFetnbSdiGKPwTt9mg=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -38,7 +38,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/",
0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d,
0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f,
0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d,
- 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735811, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.6e-05,
- connect = 0, pretransfer = 0.000251, starttransfer = 0.213781,
- total = 0.213824)), class = "response")
+ 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080107, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.5e-05,
+ connect = 0, pretransfer = 0.00019, starttransfer = 0.138059,
+ total = 0.138094)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R b/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R
index ae7c78f5..9ebea21a 100644
--- a/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R
+++ b/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/BIOSOLDIS2021?projection=chemicallistwithdtxsids",
status_code = 400L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:15 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "11389ee8-d7fd-402a-4ae5-ef45e2658308",
+ `x-vcap-request-id` = "05dcf5ce-1a61-4941-528a-c5f63d313d25",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BnZPkUeJQt-W_p7JaeW2j0xu27MLvNjcVLz5l5ZGdF5QKUtG5bj12g=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "h5DGWniwzZHLcWmdw4S6LNdXHlea0xi4DAN7T2p9Kct8dcBrwyJzRQ=="), class = c("insensitive",
"list")), all_headers = list(list(status = 400L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:53 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:15 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "11389ee8-d7fd-402a-4ae5-ef45e2658308",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "05dcf5ce-1a61-4941-528a-c5f63d313d25",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BnZPkUeJQt-W_p7JaeW2j0xu27MLvNjcVLz5l5ZGdF5QKUtG5bj12g=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "h5DGWniwzZHLcWmdw4S6LNdXHlea0xi4DAN7T2p9Kct8dcBrwyJzRQ=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/BIOS
0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6e,
0x61, 0x6d, 0x65, 0x2f, 0x42, 0x49, 0x4f, 0x53, 0x4f, 0x4c,
0x44, 0x49, 0x53, 0x32, 0x30, 0x32, 0x31, 0x22, 0x0a, 0x7d
- )), date = structure(1730735813, class = c("POSIXct", "POSIXt"
- ), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.1e-05,
- connect = 0, pretransfer = 0.000187, starttransfer = 0.092628,
- total = 0.092664)), class = "response")
+ )), date = structure(1731080115, class = c("POSIXct", "POSIXt"
+ ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.5e-05,
+ connect = 0, pretransfer = 0.000167, starttransfer = 0.25819,
+ total = 0.258222)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R b/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R
index c902c7a2..404de04a 100644
--- a/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R
+++ b/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/DTXSID7020182?projection=chemicallistwithdtxsids",
status_code = 400L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:12 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "64aa48af-7c8f-4fc5-685d-e6a0ab8f80a2",
+ `x-vcap-request-id` = "d18602ac-a7df-43f9-66b6-8d24b9fce9d2",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "LpOl98ntuCMeTMc9j3aHSZZP-Kimco1-dARF7SQbMn8nrJmHnq5bUw=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "c-ynhS9Mi1rlBWT8kxu1tnxz3aFnvtPIWrklQLGaHqqBJ_DfQFBoXA=="), class = c("insensitive",
"list")), all_headers = list(list(status = 400L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:12 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "64aa48af-7c8f-4fc5-685d-e6a0ab8f80a2",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d18602ac-a7df-43f9-66b6-8d24b9fce9d2",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "LpOl98ntuCMeTMc9j3aHSZZP-Kimco1-dARF7SQbMn8nrJmHnq5bUw=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "c-ynhS9Mi1rlBWT8kxu1tnxz3aFnvtPIWrklQLGaHqqBJ_DfQFBoXA=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/DTXS
0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6e,
0x61, 0x6d, 0x65, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49, 0x44,
0x37, 0x30, 0x32, 0x30, 0x31, 0x38, 0x32, 0x22, 0x0a, 0x7d
- )), date = structure(1730735772, class = c("POSIXct", "POSIXt"
- ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.8e-05,
- connect = 0, pretransfer = 0.000185, starttransfer = 0.01646,
- total = 0.016491)), class = "response")
+ )), date = structure(1731080067, class = c("POSIXct", "POSIXt"
+ ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.7e-05,
+ connect = 0, pretransfer = 0.000149, starttransfer = 0.033406,
+ total = 0.033439)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-type.R b/tests/testthat/chemical-batch/chemical/list/search/by-type.R
index 35c600b7..b1f325d0 100644
--- a/tests/testthat/chemical-batch/chemical/list/search/by-type.R
+++ b/tests/testthat/chemical-batch/chemical/list/search/by-type.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-type/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:07 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "835f7dae-b02f-4586-487e-8a3dd4265481",
+ `x-vcap-request-id` = "b53494aa-68b8-42a3-6024-5ae773269652",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "kfw8hdiH8MUpFo-cKBPMJkegCtzZp2mj_hM4caMdIQMDAVwDybbR7w=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "xr_Eil53XUoYMWO168xGSy_ygJIznZOXtN1x14Went5ZYBPmX4VIYQ=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:07 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "835f7dae-b02f-4586-487e-8a3dd4265481",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "b53494aa-68b8-42a3-6024-5ae773269652",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "kfw8hdiH8MUpFo-cKBPMJkegCtzZp2mj_hM4caMdIQMDAVwDybbR7w=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "xr_Eil53XUoYMWO168xGSy_ygJIznZOXtN1x14Went5ZYBPmX4VIYQ=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -38,7 +38,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-type/",
0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d,
0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f,
0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d,
- 0x74, 0x79, 0x70, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735811, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 7.5e-05,
- connect = 0, pretransfer = 0.000239, starttransfer = 0.213924,
- total = 0.21398)), class = "response")
+ 0x74, 0x79, 0x70, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080107, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 8.4e-05,
+ connect = 0, pretransfer = 0.000152, starttransfer = 0.265014,
+ total = 0.265056)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R b/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R
index a0dd47a9..91fa04e5 100644
--- a/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R
+++ b/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-dtxcid/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:06 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "e5d9aa83-3c67-4fa9-5305-f942b7cb870b",
+ `x-vcap-request-id` = "f824af01-b7fa-4e59-7236-cec430273a3b",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "D1EPex_nYdGyONVU9svEsTQNR5WLWHBHlR8-kg_GhRj9mPlP3WlvIA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Df2TnfiGZxLBDx_7ztOerBITRl3B4MfNxFUOzMypzqjVB9rFpam8dw=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:06 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e5d9aa83-3c67-4fa9-5305-f942b7cb870b",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f824af01-b7fa-4e59-7236-cec430273a3b",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "D1EPex_nYdGyONVU9svEsTQNR5WLWHBHlR8-kg_GhRj9mPlP3WlvIA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "Df2TnfiGZxLBDx_7ztOerBITRl3B4MfNxFUOzMypzqjVB9rFpam8dw=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-dtxcid
0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f,
0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73, 0x65,
0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74,
- 0x78, 0x63, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735811, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.7e-05,
- connect = 0, pretransfer = 0.000171, starttransfer = 0.226174,
- total = 0.226205)), class = "response")
+ 0x78, 0x63, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080106, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.9e-05,
+ connect = 0, pretransfer = 0.000141, starttransfer = 0.236477,
+ total = 0.236528)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R b/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R
index 3470d8de..92d81c9e 100644
--- a/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R
+++ b/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-formula/",
status_code = 404L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:50 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:06 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "c057d873-e75e-4a21-473a-902c693b52eb",
+ `x-vcap-request-id` = "702a4102-994c-48c0-4334-3acf86318cf9",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "qw8vfFk7ydqLLfIiirwC4kt-6-zdLfyDBSC9cAnirJoCzKovah14pg=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "5rOsBYA9gN0lZ6Gm19Q66I1JvyUc7j-WCb0bP8d72ooGo0wZdXzZ1Q=="), class = c("insensitive",
"list")), all_headers = list(list(status = 404L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:50 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:35:06 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "c057d873-e75e-4a21-473a-902c693b52eb",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "702a4102-994c-48c0-4334-3acf86318cf9",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "qw8vfFk7ydqLLfIiirwC4kt-6-zdLfyDBSC9cAnirJoCzKovah14pg=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "5rOsBYA9gN0lZ6Gm19Q66I1JvyUc7j-WCb0bP8d72ooGo0wZdXzZ1Q=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-formul
0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73,
0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x66,
0x6f, 0x72, 0x6d, 0x75, 0x6c, 0x61, 0x2f, 0x22, 0x0a, 0x7d
- )), date = structure(1730735810, class = c("POSIXct", "POSIXt"
- ), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.3e-05,
- connect = 0, pretransfer = 0.000227, starttransfer = 0.198082,
- total = 0.198144)), class = "response")
+ )), date = structure(1731080106, class = c("POSIXct", "POSIXt"
+ ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.4e-05,
+ connect = 0, pretransfer = 0.000135, starttransfer = 0.235584,
+ total = 0.235616)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R
index 28893318..dcb33abe 100644
--- a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R
+++ b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R
@@ -1,24 +1,24 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/",
status_code = 400L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:18 GMT", `x-xss-protection` = "1; mode=block",
+ date = "Fri, 08 Nov 2024 15:34:34 GMT", `x-xss-protection` = "1; mode=block",
`x-frame-options` = "DENY", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", vary = "Origin",
vary = "Access-Control-Request-Method", vary = "Access-Control-Request-Headers",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "47b8c14c-1a91-4d91-7a46-cacd7eb889a6",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "ilpNxgH3eyB4oFNWvgjRTpGf50T2OJX3B9EVTxmMnXpH7F7RP0Rg2g=="), class = c("insensitive",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "87ec5d5d-5c99-4256-4b5f-848ce9189224",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "2__gJTozN8K5vWn5UkVo5hzwEy8f5J0MzMmysFuc8StR5OCwC-nFCA=="), class = c("insensitive",
"list")), all_headers = list(list(status = 400L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:18 GMT", `x-xss-protection` = "1; mode=block",
+ date = "Fri, 08 Nov 2024 15:34:34 GMT", `x-xss-protection` = "1; mode=block",
`x-frame-options` = "DENY", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
vary = "Origin", vary = "Access-Control-Request-Method",
vary = "Access-Control-Request-Headers", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "47b8c14c-1a91-4d91-7a46-cacd7eb889a6",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "ilpNxgH3eyB4oFNWvgjRTpGf50T2OJX3B9EVTxmMnXpH7F7RP0Rg2g=="), class = c("insensitive",
+ `x-vcap-request-id` = "87ec5d5d-5c99-4256-4b5f-848ce9189224",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "2__gJTozN8K5vWn5UkVo5hzwEy8f5J0MzMmysFuc8StR5OCwC-nFCA=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/"
0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c,
0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73,
0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6d,
- 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735778, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6e-05,
- connect = 0, pretransfer = 0.000199, starttransfer = 0.277549,
- total = 0.27758)), class = "response")
+ 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080074, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.9e-05,
+ connect = 0, pretransfer = 0.000137, starttransfer = 0.284748,
+ total = 0.284803)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R
index cf073715..3b3803e5 100644
--- a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R
+++ b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R
@@ -1,24 +1,24 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/",
status_code = 400L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:49 GMT", `x-xss-protection` = "1; mode=block",
+ date = "Fri, 08 Nov 2024 15:35:04 GMT", `x-xss-protection` = "1; mode=block",
`x-frame-options` = "DENY", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", vary = "Origin",
vary = "Access-Control-Request-Method", vary = "Access-Control-Request-Headers",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "24cd380e-f0bd-448e-7098-a533fb8ff71b",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "X_5AtMaOLSFg0Am_9nPNEACTWc1CVaoEePcbF0hbKn_DZrAu6XOTBQ=="), class = c("insensitive",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "1405f2a1-0bf2-45a2-681e-eeb5c833a128",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "S2IjY3X-DsYPse4qYgHe2LVVB8IjDeL28Lc4RaSSdMxxVyAgPoRSBg=="), class = c("insensitive",
"list")), all_headers = list(list(status = 400L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:49 GMT", `x-xss-protection` = "1; mode=block",
+ date = "Fri, 08 Nov 2024 15:35:04 GMT", `x-xss-protection` = "1; mode=block",
`x-frame-options` = "DENY", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
vary = "Origin", vary = "Access-Control-Request-Method",
vary = "Access-Control-Request-Headers", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "24cd380e-f0bd-448e-7098-a533fb8ff71b",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "X_5AtMaOLSFg0Am_9nPNEACTWc1CVaoEePcbF0hbKn_DZrAu6XOTBQ=="), class = c("insensitive",
+ `x-vcap-request-id` = "1405f2a1-0bf2-45a2-681e-eeb5c833a128",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "S2IjY3X-DsYPse4qYgHe2LVVB8IjDeL28Lc4RaSSdMxxVyAgPoRSBg=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/"
0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c,
0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73,
0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6d,
- 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1730735809, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.1e-05,
- connect = 0, pretransfer = 0.000317, starttransfer = 0.268133,
- total = 0.268168)), class = "response")
+ 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1731080104, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 7.4e-05,
+ connect = 0, pretransfer = 0.000159, starttransfer = 0.29903,
+ total = 0.299065)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-33d060-POST.json b/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-33d060-POST.json
index 6577ae30..7065724d 100644
--- a/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-33d060-POST.json
+++ b/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-33d060-POST.json
@@ -7,9 +7,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkoa-octanol-air",
"propType": "experimental",
- "unit": null
+ "unit": null,
+ "propertyId": "logkoa-octanol-air"
},
{
"name": "LogKow: Octanol-Water",
@@ -19,9 +19,9 @@
"description": "Ran, Y.; He, Y.; Yang, G.; Johnson, J. L. H.; Yalkowsky, S. H. Estimation of aqueous solubility of organic compounds by using the general solubility equation. (Chemosphere 2002, 48, 487–509<\/a>)\r\n",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkow-octanol-water",
"propType": "experimental",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -31,9 +31,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkow-octanol-water",
"propType": "experimental",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "Melting Point",
@@ -43,9 +43,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -55,9 +55,9 @@
"description": "Jean-Claude Bradley's Legacy Dataset of Open Melting Points. Website: http://dx.doi.org/10.6084/m9.figshare.1031637<\/a>",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Vapor Pressure",
@@ -67,9 +67,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "vapor-pressure",
"propType": "experimental",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Water Solubility",
@@ -79,9 +79,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "experimental",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -91,9 +91,9 @@
"description": "Ran, Y.; He, Y.; Yang, G.; Johnson, J. L. H.; Yalkowsky, S. H. Estimation of aqueous solubility of organic compounds by using the general solubility equation. (Chemosphere 2002, 48, 487–509<\/a>)\r\n",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "experimental",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -103,9 +103,9 @@
"description": "Kovdienko, Nikolay A., et al. \"Application of random forest and multiple linear regression techniques to QSPR prediction of an aqueous solubility for military compounds.\" Molecular informatics 29.5 (2010): 394-406. <\/a>",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "experimental",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Boiling Point",
@@ -115,9 +115,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Boiling Point",
@@ -127,9 +127,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Boiling Point",
@@ -139,9 +139,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Boiling Point",
@@ -151,9 +151,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Density",
@@ -163,9 +163,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "density",
"propType": "predicted",
- "unit": "g/cm^3"
+ "unit": "g/cm^3",
+ "propertyId": "density"
},
{
"name": "Density",
@@ -175,9 +175,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "density",
"propType": "predicted",
- "unit": "g/cm^3"
+ "unit": "g/cm^3",
+ "propertyId": "density"
},
{
"name": "Flash Point",
@@ -187,9 +187,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "flash-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "flash-point"
},
{
"name": "Flash Point",
@@ -199,9 +199,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "flash-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "flash-point"
},
{
"name": "Henry's Law",
@@ -211,9 +211,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "henrys-law",
"propType": "predicted",
- "unit": "atm-m3/mole"
+ "unit": "atm-m3/mole",
+ "propertyId": "henrys-law"
},
{
"name": "Index of Refraction",
@@ -223,9 +223,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "index-of-refraction",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "index-of-refraction"
},
{
"name": "LogKoa: Octanol-Air",
@@ -235,9 +235,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkoa-octanol-air",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkoa-octanol-air"
},
{
"name": "LogKow: Octanol-Water",
@@ -247,9 +247,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -259,9 +259,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -271,9 +271,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -283,9 +283,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "Melting Point",
@@ -295,9 +295,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "melting-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -307,9 +307,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "melting-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -319,9 +319,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "melting-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Molar Refractivity",
@@ -331,9 +331,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "molar-refractivity",
"propType": "predicted",
- "unit": "cm^3"
+ "unit": "cm^3",
+ "propertyId": "molar-refractivity"
},
{
"name": "Molar Volume",
@@ -343,9 +343,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "molar-volume",
"propType": "predicted",
- "unit": "cm^3"
+ "unit": "cm^3",
+ "propertyId": "molar-volume"
},
{
"name": "Polarizability",
@@ -355,9 +355,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "polarizability",
"propType": "predicted",
- "unit": "Å^3"
+ "unit": "Å^3",
+ "propertyId": "polarizability"
},
{
"name": "Surface Tension",
@@ -367,9 +367,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "surface-tension",
"propType": "predicted",
- "unit": "dyn/cm"
+ "unit": "dyn/cm",
+ "propertyId": "surface-tension"
},
{
"name": "Thermal Conductivity",
@@ -379,9 +379,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "thermal-conductivity",
"propType": "predicted",
- "unit": "mW/(m*K)"
+ "unit": "mW/(m*K)",
+ "propertyId": "thermal-conductivity"
},
{
"name": "Vapor Pressure",
@@ -391,9 +391,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "vapor-pressure",
"propType": "predicted",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Vapor Pressure",
@@ -403,9 +403,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "vapor-pressure",
"propType": "predicted",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Vapor Pressure",
@@ -415,9 +415,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "vapor-pressure",
"propType": "predicted",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Water Solubility",
@@ -427,9 +427,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -439,9 +439,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -451,9 +451,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -463,9 +463,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID2021315",
"dtxcid": "DTXCID001315",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Boiling Point",
@@ -475,9 +475,9 @@
"description": "Alfa Aesar is a leading international manufacturer, supplier and distributor of fine chemicals, metals, and materials. Company website: https://www.alfa.com/<\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "boiling-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "LogKow: Octanol-Water",
@@ -487,9 +487,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "logkow-octanol-water",
"propType": "experimental",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "Melting Point",
@@ -499,9 +499,9 @@
"description": "Alfa Aesar is a leading international manufacturer, supplier and distributor of fine chemicals, metals, and materials. Company website: https://www.alfa.com/<\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -511,9 +511,9 @@
"description": "Jean-Claude Bradley's Legacy Dataset of Open Melting Points. Website: http://dx.doi.org/10.6084/m9.figshare.1031637<\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -523,9 +523,9 @@
"description": "Jean-Claude Bradley's Legacy Dataset of Open Melting Points. Website: http://dx.doi.org/10.6084/m9.figshare.1031637<\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -535,9 +535,9 @@
"description": "Tokyo Chemical Industry Co. Ltd. (TCI) is a manufacturer of research chemicals and produces more than 23,000 mainly organic chemicals. Company website: http://www.tcichemicals.com/<\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -547,9 +547,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -559,9 +559,9 @@
"description": "Merck Millipore Merck Millipore offers tools and technologies to support the research, development and production of biotechnology and pharmaceutical drug therapies.Company website: http://www.merckmillipore.com/<\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "experimental",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Water Solubility",
@@ -571,9 +571,9 @@
"description": "Tetko, Igor V., et al. \"Estimation of aqueous solubility of chemical compounds using E-state indices.\" . J. Chem. Inf. and Comp. Sci. 41.6 (2001): 1488-1493<\/a>\r\n\r\n\r\n",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "experimental",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -583,9 +583,9 @@
"description": "The PHYSPROP data sets are the publicly available data files underpinning the EPISuiteTM prediction models. The data were curated by NCCT using a combination of manual and automated processing routines with only the highest quality data reported.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "experimental",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -595,9 +595,9 @@
"description": "Kovdienko, Nikolay A., et al. \"Application of random forest and multiple linear regression techniques to QSPR prediction of an aqueous solubility for military compounds.\" Molecular informatics 29.5 (2010): 394-406. <\/a>",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "experimental",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Boiling Point",
@@ -607,9 +607,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Boiling Point",
@@ -619,9 +619,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Boiling Point",
@@ -631,9 +631,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Boiling Point",
@@ -643,9 +643,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "boiling-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "boiling-point"
},
{
"name": "Density",
@@ -655,9 +655,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "density",
"propType": "predicted",
- "unit": "g/cm^3"
+ "unit": "g/cm^3",
+ "propertyId": "density"
},
{
"name": "Density",
@@ -667,9 +667,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "density",
"propType": "predicted",
- "unit": "g/cm^3"
+ "unit": "g/cm^3",
+ "propertyId": "density"
},
{
"name": "Flash Point",
@@ -679,9 +679,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "flash-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "flash-point"
},
{
"name": "Flash Point",
@@ -691,9 +691,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "flash-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "flash-point"
},
{
"name": "Henry's Law",
@@ -703,9 +703,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "henrys-law",
"propType": "predicted",
- "unit": "atm-m3/mole"
+ "unit": "atm-m3/mole",
+ "propertyId": "henrys-law"
},
{
"name": "Index of Refraction",
@@ -715,9 +715,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "index-of-refraction",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "index-of-refraction"
},
{
"name": "LogKoa: Octanol-Air",
@@ -727,9 +727,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "logkoa-octanol-air",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkoa-octanol-air"
},
{
"name": "LogKow: Octanol-Water",
@@ -739,9 +739,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -751,9 +751,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -763,9 +763,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "LogKow: Octanol-Water",
@@ -775,9 +775,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "logkow-octanol-water",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "logkow-octanol-water"
},
{
"name": "Melting Point",
@@ -787,9 +787,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -799,9 +799,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Melting Point",
@@ -811,9 +811,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "melting-point",
"propType": "predicted",
- "unit": "°C"
+ "unit": "°C",
+ "propertyId": "melting-point"
},
{
"name": "Molar Refractivity",
@@ -823,9 +823,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "molar-refractivity",
"propType": "predicted",
- "unit": "cm^3"
+ "unit": "cm^3",
+ "propertyId": "molar-refractivity"
},
{
"name": "Molar Volume",
@@ -835,9 +835,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "molar-volume",
"propType": "predicted",
- "unit": "cm^3"
+ "unit": "cm^3",
+ "propertyId": "molar-volume"
},
{
"name": "pKa Basic Apparent",
@@ -847,9 +847,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "pka-basic-apparent",
"propType": "predicted",
- "unit": null
+ "unit": null,
+ "propertyId": "pka-basic-apparent"
},
{
"name": "Polarizability",
@@ -859,9 +859,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "polarizability",
"propType": "predicted",
- "unit": "Å^3"
+ "unit": "Å^3",
+ "propertyId": "polarizability"
},
{
"name": "Surface Tension",
@@ -871,9 +871,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "surface-tension",
"propType": "predicted",
- "unit": "dyn/cm"
+ "unit": "dyn/cm",
+ "propertyId": "surface-tension"
},
{
"name": "Thermal Conductivity",
@@ -883,9 +883,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "thermal-conductivity",
"propType": "predicted",
- "unit": "mW/(m*K)"
+ "unit": "mW/(m*K)",
+ "propertyId": "thermal-conductivity"
},
{
"name": "Vapor Pressure",
@@ -895,9 +895,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "vapor-pressure",
"propType": "predicted",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Vapor Pressure",
@@ -907,9 +907,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "vapor-pressure",
"propType": "predicted",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Vapor Pressure",
@@ -919,9 +919,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "vapor-pressure",
"propType": "predicted",
- "unit": "mmHg"
+ "unit": "mmHg",
+ "propertyId": "vapor-pressure"
},
{
"name": "Viscosity",
@@ -931,9 +931,9 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "viscosity",
"propType": "predicted",
- "unit": "cP"
+ "unit": "cP",
+ "propertyId": "viscosity"
},
{
"name": "Water Solubility",
@@ -943,9 +943,9 @@
"description": "ACD/Labs physicochemical properties are predicted by the ACD/Labs Percepta Platform<\/a>. ",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -955,9 +955,9 @@
"description": "OPERA is a free and open source/open data suite of QSAR Models providing predictions and additional information including applicability domain and accuracy assessment, as described in the publication OPERA models for predicting physicochemical properties and environmental fate endpoints<\/a>. All models were built on curated data and standardized chemical structures as described in the publication An automated curation procedure for addressing chemical errors and inconsistencies in public datasets used in QSAR modelling<\/a>. All OPERA properties are predicted under ambient conditions of 760mm of Hg at 25 degrees Celsius.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -967,9 +967,9 @@
"description": "EPISUITE Estimation Programs Interface Suite™<\/a> is a Windows®-based suite of physical/chemical property and environmental fate estimation programs developed by EPA’s and Syracuse Research Corp.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
},
{
"name": "Water Solubility",
@@ -979,8 +979,8 @@
"description": "The Toxicity Estimation Software Tool (TEST)<\/a> is an EPA software application developed to allow users to easily estimate the toxicity of chemicals using Quantitative Structure Activity Relationships (QSARs) methodologies.",
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
- "propertyId": "water-solubility",
"propType": "predicted",
- "unit": "mol/L"
+ "unit": "mol/L",
+ "propertyId": "water-solubility"
}
]
diff --git a/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json b/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json
index bf6804bc..4b692a71 100644
--- a/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json
+++ b/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json
@@ -1,38 +1,38 @@
[
{
+ "hasStructureImage": 1,
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
"casrn": "80-05-7",
"preferredName": "Bisphenol A",
- "hasStructureImage": 1,
- "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
- "isMarkush": false,
- "rank": 1,
"searchName": "DSSTox_Substance_Id",
- "searchValue": "DTXSID7020182"
+ "searchValue": "DTXSID7020182",
+ "rank": 1,
+ "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
+ "isMarkush": false
},
{
+ "hasStructureImage": 1,
"dtxsid": "DTXSID70201820",
"dtxcid": "DTXCID00124311",
"casrn": "536-95-8",
"preferredName": "Carinamide",
- "hasStructureImage": 1,
- "smiles": "OC(=O)C1=CC=C(NS(=O)(=O)CC2=CC=CC=C2)C=C1",
- "isMarkush": false,
- "rank": 1,
"searchName": "DSSTox_Substance_Id",
- "searchValue": "DTXSID70201820"
+ "searchValue": "DTXSID70201820",
+ "rank": 1,
+ "smiles": "OC(=O)C1=CC=C(NS(=O)(=O)CC2=CC=CC=C2)C=C1",
+ "isMarkush": false
},
{
+ "hasStructureImage": 1,
"dtxsid": "DTXSID70201825",
"dtxcid": "DTXCID00124316",
"casrn": "53605-00-8",
"preferredName": "Phosphorothioic acid, O,O-diethyl O-3-pyridazinyl ester",
- "hasStructureImage": 1,
- "smiles": "CCOP(=S)(OCC)OC1=NN=CC=C1",
- "isMarkush": false,
- "rank": 1,
"searchName": "DSSTox_Substance_Id",
- "searchValue": "DTXSID70201825"
+ "searchValue": "DTXSID70201825",
+ "rank": 1,
+ "smiles": "CCOP(=S)(OCC)OC1=NN=CC=C1",
+ "isMarkush": false
}
]
diff --git a/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R b/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R
index eeb6b7a0..96150ab5 100644
--- a/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R
+++ b/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/search/contain/gvfdsr7",
status_code = 400L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:44 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:58 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "eed0566d-549d-4ecf-6598-2d2cc67c3a35",
+ `x-vcap-request-id` = "c93d29cf-2a0b-4f17-7f74-226df678751b",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "OByeEMqQUgMaInI3esyCS3zxM3pVELJxKyQB7SjRcLeh1FivW5vsPA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "bZ3Ow7vGVp4CDHraLEwh8EtYDAJTSyCBpiZapUH20DAEBeYET0rATA=="), class = c("insensitive",
"list")), all_headers = list(list(status = 400L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:44 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:58 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "eed0566d-549d-4ecf-6598-2d2cc67c3a35",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "c93d29cf-2a0b-4f17-7f74-226df678751b",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "OByeEMqQUgMaInI3esyCS3zxM3pVELJxKyQB7SjRcLeh1FivW5vsPA=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "bZ3Ow7vGVp4CDHraLEwh8EtYDAJTSyCBpiZapUH20DAEBeYET0rATA=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -42,7 +42,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/contain/gvfdsr7",
0x72, 0x37, 0x22, 0x2c, 0x0a, 0x20, 0x20, 0x22, 0x73, 0x75,
0x67, 0x67, 0x65, 0x73, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x22,
0x20, 0x3a, 0x20, 0x5b, 0x20, 0x6e, 0x75, 0x6c, 0x6c, 0x20,
- 0x5d, 0x0a, 0x7d)), date = structure(1730735804, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.9e-05,
- connect = 0, pretransfer = 0.000263, starttransfer = 1.904904,
- total = 1.904936)), class = "response")
+ 0x5d, 0x0a, 0x7d)), date = structure(1731080098, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6e-05,
+ connect = 0, pretransfer = 0.000173, starttransfer = 1.73128,
+ total = 1.731324)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json b/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json
index f12c4e1f..15f39400 100644
--- a/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json
+++ b/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json
@@ -1,14 +1,14 @@
[
{
+ "hasStructureImage": 1,
"dtxsid": "DTXSID7020182",
"dtxcid": "DTXCID30182",
"casrn": "80-05-7",
"preferredName": "Bisphenol A",
- "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
- "isMarkush": false,
- "rank": 1,
- "hasStructureImage": 1,
"searchName": "DSSTox_Substance_Id",
- "searchValue": "DTXSID7020182"
+ "searchValue": "DTXSID7020182",
+ "rank": 1,
+ "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1",
+ "isMarkush": false
}
]
diff --git a/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R b/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R
index 89074f51..dc27ffce 100644
--- a/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R
+++ b/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R
@@ -1,21 +1,21 @@
structure(list(url = "https://api-ccte.epa.gov/chemical/search/start-with/gvfdsr7",
status_code = 400L, headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:40 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:55 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff",
- `x-vcap-request-id` = "9a464347-4814-4dba-5b81-1897e047c1f4",
+ `x-vcap-request-id` = "25156b0c-dcdb-473d-7f29-ebc51132dcde",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "E2e657aQRRVWfnJudZWMHgzz0ZMHlwtWwz9KVHPG2j_L79NB0Hv7Ig=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "ci_affIaEQ4eREN6KkxnBWpa7ugDrivUHYLxU77LRSp5MmIa3A5h3w=="), class = c("insensitive",
"list")), all_headers = list(list(status = 400L, version = "HTTP/1.1",
headers = structure(list(`content-type` = "application/problem+json",
`transfer-encoding` = "chunked", connection = "keep-alive",
- date = "Mon, 04 Nov 2024 15:56:40 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
+ date = "Fri, 08 Nov 2024 15:34:55 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform",
`strict-transport-security` = "max-age=31536000",
- `x-content-type-options` = "nosniff", `x-vcap-request-id` = "9a464347-4814-4dba-5b81-1897e047c1f4",
+ `x-content-type-options` = "nosniff", `x-vcap-request-id` = "25156b0c-dcdb-473d-7f29-ebc51132dcde",
`x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY",
- `x-cache` = "Error from cloudfront", via = "1.1 6b7e1e42d74fd61097787cc6c1a37c34.cloudfront.net (CloudFront)",
- `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "E2e657aQRRVWfnJudZWMHgzz0ZMHlwtWwz9KVHPG2j_L79NB0Hv7Ig=="), class = c("insensitive",
+ `x-cache` = "Error from cloudfront", via = "1.1 e84404231b384141b3b0f51e40964ef6.cloudfront.net (CloudFront)",
+ `x-amz-cf-pop` = "IAD55-P7", `x-amz-cf-id` = "ci_affIaEQ4eREN6KkxnBWpa7ugDrivUHYLxU77LRSp5MmIa3A5h3w=="), class = c("insensitive",
"list")))), cookies = structure(list(domain = logical(0),
flag = logical(0), path = logical(0), secure = logical(0),
expiration = structure(numeric(0), class = c("POSIXct",
@@ -42,7 +42,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/start-with/gvfdsr
0x66, 0x64, 0x73, 0x72, 0x37, 0x22, 0x2c, 0x0a, 0x20, 0x20,
0x22, 0x73, 0x75, 0x67, 0x67, 0x65, 0x73, 0x74, 0x69, 0x6f,
0x6e, 0x73, 0x22, 0x20, 0x3a, 0x20, 0x5b, 0x20, 0x6e, 0x75,
- 0x6c, 0x6c, 0x20, 0x5d, 0x0a, 0x7d)), date = structure(1730735800, class = c("POSIXct",
- "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.4e-05,
- connect = 0, pretransfer = 0.000215, starttransfer = 0.226111,
- total = 0.226141)), class = "response")
+ 0x6c, 0x6c, 0x20, 0x5d, 0x0a, 0x7d)), date = structure(1731080095, class = c("POSIXct",
+ "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.1e-05,
+ connect = 0, pretransfer = 0.000127, starttransfer = 0.311361,
+ total = 0.311395)), class = "response")
diff --git a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json
index 84937f9a..fc60b4e0 100644
--- a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json
+++ b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json
@@ -1,11 +1,7 @@
[
{
- "valid": [
- "4,4’-Propane-2,2-diyldiphenol",
- "80-05-7",
- "Bisphenol A",
- "Phenol, 4,4'-(1-methylethylidene)bis-"
- ],
+ "beilstein": null,
+ "alternateCasrn": null,
"good": [
"2,2-Bis(4-hydroxyphenyl)propane",
"2,2-Bis(4'-hydroxyphenyl) propane",
@@ -57,8 +53,6 @@
"28106-82-3",
"37808-08-5"
],
- "dtxsid": "DTXSID7020182",
- "pcCode": null,
"other": [
"1,1'-(1-Methylethylidene)bisphenylol, 9CI",
"(1-methylethylidene)bis-Phenol",
@@ -265,7 +259,13 @@
"Ucar bisphenol HP",
"UNII-MLT3645I99"
],
- "beilstein": null,
- "alternateCasrn": null
+ "valid": [
+ "4,4’-Propane-2,2-diyldiphenol",
+ "80-05-7",
+ "Bisphenol A",
+ "Phenol, 4,4'-(1-methylethylidene)bis-"
+ ],
+ "dtxsid": "DTXSID7020182",
+ "pcCode": null
}
]